3,6,9-Trimethyl-5-(3,4,5-trihydroxyoxan-2-yl)oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione
| Internal ID | c90fdccb-3082-487c-ad7b-5d50a8df4e27 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | 3,6,9-trimethyl-5-(3,4,5-trihydroxyoxan-2-yl)oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
| SMILES (Canonical) | CC1C2CC(C(=C3C(C2OC1=O)C(=CC3=O)C)C)OC4C(C(C(CO4)O)O)O |
| SMILES (Isomeric) | CC1C2CC(C(=C3C(C2OC1=O)C(=CC3=O)C)C)OC4C(C(C(CO4)O)O)O |
| InChI | InChI=1S/C20H26O8/c1-7-4-11(21)15-9(3)13(27-20-17(24)16(23)12(22)6-26-20)5-10-8(2)19(25)28-18(10)14(7)15/h4,8,10,12-14,16-18,20,22-24H,5-6H2,1-3H3 |
| InChI Key | KQWVEEIQLGYIAV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16276778 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
![2D Structure of 3,6,9-Trimethyl-5-(3,4,5-trihydroxyoxan-2-yl)oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione](https://plantaedb.com/storage/docs/compounds/2023/11/70210f10-8573-11ee-a28c-35f67e31ca84.jpg "2D Structure of 3,6,9-Trimethyl-5-(3,4,5-trihydroxyoxan-2-yl)oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.70% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.12% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.29% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.29% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.72% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.63% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.37% | 96.61% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.31% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.19% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.97% | 91.49% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.48% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.20% | 90.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.93% | 94.80% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.66% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lactuca triangulata |
| PubChem | 163014539 |
| LOTUS | LTS0219020 |
| wikiData | Q105144847 |