1-hydroxy-10-(5-hydroxy-2,4-dimethoxy-7-methyl-10-oxo-9H-anthracen-9-yl)-6,8-dimethoxy-3-methyl-10H-anthracen-9-one
| Internal ID | d3569eaa-2e99-4333-86ef-acddb40a2021 |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | 1-hydroxy-10-(5-hydroxy-2,4-dimethoxy-7-methyl-10-oxo-9H-anthracen-9-yl)-6,8-dimethoxy-3-methyl-10H-anthracen-9-one |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C5=C(C(=CC(=C5)C)O)C(=O)C6=C4C=C(C=C6OC)OC)C=C(C=C3OC)OC |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C5=C(C(=CC(=C5)C)O)C(=O)C6=C4C=C(C=C6OC)OC)C=C(C=C3OC)OC |
| InChI | InChI=1S/C34H30O8/c1-15-7-19-27(21-11-17(39-3)13-25(41-5)31(21)33(37)29(19)23(35)9-15)28-20-8-16(2)10-24(36)30(20)34(38)32-22(28)12-18(40-4)14-26(32)42-6/h7-14,27-28,35-36H,1-6H3 |
| InChI Key | LIZAXDZGERGFKW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C34H30O8 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.19406791 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 7.10 |
| NSC357286 |
| 1-hydroxy-10-(5-hydroxy-2,4-dimethoxy-7-methyl-10-oxo-9H-anthracen-9-yl)-6,8-dimethoxy-3-methyl-10H-anthracen-9-one |
| CHEMBL4566423 |
| DTXSID80320293 |
| NSC-357286 |
| BIANTHRONE DERIV (ASPERGILLUS WENTII) |
| 4,4'-Dihydroxy-5,5',7,7'-tetramethoxy-2,2'-dimethyl[9,9'-bianthracene]-10,10'(9H,9'H)-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.51% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.08% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.09% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.77% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.53% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.35% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.31% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.25% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.88% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.60% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.42% | 92.94% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 83.52% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.02% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.33% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 337815 |
| LOTUS | LTS0082237 |
| wikiData | Q82077335 |