7-Methoxypaxilline
Internal ID | 29fd6681-7a41-4166-ac77-10d8654fc8d9 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,2R,5S,7R,11S,14S)-11-hydroxy-7-(2-hydroxypropan-2-yl)-5-methoxy-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaen-8-one |
SMILES (Canonical) | CC12CCC3(C(=CC(=O)C(O3)C(C)(C)O)C1(CCC4C2(C5=C(C4)C6=CC=CC=C6N5)C)O)OC |
SMILES (Isomeric) | C[C@]12CC[C@]3(C(=CC(=O)[C@H](O3)C(C)(C)O)[C@@]1(CC[C@@H]4[C@@]2(C5=C(C4)C6=CC=CC=C6N5)C)O)OC |
InChI | InChI=1S/C28H35NO5/c1-24(2,31)23-20(30)15-21-27(32)11-10-16-14-18-17-8-6-7-9-19(17)29-22(18)26(16,4)25(27,3)12-13-28(21,33-5)34-23/h6-9,15-16,23,29,31-32H,10-14H2,1-5H3/t16-,23-,25+,26+,27+,28-/m0/s1 |
InChI Key | BTLNUERHGGHXJF-OHPGCOBXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H35NO5 |
Molecular Weight | 465.60 g/mol |
Exact Mass | 465.25152322 g/mol |
Topological Polar Surface Area (TPSA) | 91.80 Ų |
XlogP | 3.20 |
CHEMBL4529485 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.76% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.74% | 95.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 96.51% | 94.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.85% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.74% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.09% | 93.99% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.48% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.26% | 94.75% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.97% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.68% | 94.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.60% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.38% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.07% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.97% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.80% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.04% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.94% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.41% | 95.89% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.62% | 88.56% |
CHEMBL2535 | P11166 | Glucose transporter | 86.28% | 98.75% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.01% | 93.04% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.61% | 97.05% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.45% | 85.94% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.11% | 95.71% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.60% | 96.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.81% | 90.08% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.49% | 95.56% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 82.32% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.66% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.53% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 145721023 |
LOTUS | LTS0129068 |
wikiData | Q105159667 |