7-Methoxy-4-methylindeno[1,2-b]pyridin-5-one
| Internal ID | 859f4764-da77-417a-9dce-bb9885669c2b |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 7-methoxy-4-methylindeno[1,2-b]pyridin-5-one |
| SMILES (Canonical) | CC1=C2C(=NC=C1)C3=C(C2=O)C=C(C=C3)OC |
| SMILES (Isomeric) | CC1=C2C(=NC=C1)C3=C(C2=O)C=C(C=C3)OC |
| InChI | InChI=1S/C14H11NO2/c1-8-5-6-15-13-10-4-3-9(17-2)7-11(10)14(16)12(8)13/h3-7H,1-2H3 |
| InChI Key | MUQJPWNUSOKDRO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 39.20 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 7-Methoxy-4-methylindeno[1,2-b]pyridin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-methoxy-4-methylindeno12-bpyridin-5-one.jpg "2D Structure of 7-Methoxy-4-methylindeno[1,2-b]pyridin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.77% | 91.49% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 95.23% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.40% | 94.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 92.26% | 96.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.13% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.43% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.57% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.34% | 96.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.89% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.55% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.02% | 97.53% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.92% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.85% | 91.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.66% | 93.65% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.01% | 90.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.25% | 94.73% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.82% | 100.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.78% | 96.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.81% | 94.42% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.71% | 94.80% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.90% | 93.18% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.19% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Polyalthia debilis |
| Porcelia macrocarpa |
| PubChem | 23242544 |
| LOTUS | LTS0152944 |
| wikiData | Q105172657 |