Isomurrayafoline B
| Internal ID | 0a4460ba-f558-4637-9cc8-d0cce1e07e0d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 7-methoxy-3-methyl-8-(3-methylbut-2-enyl)-9H-carbazol-2-ol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)NC3=C2C=CC(=C3CC=C(C)C)OC |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)NC3=C2C=CC(=C3CC=C(C)C)OC |
| InChI | InChI=1S/C19H21NO2/c1-11(2)5-6-14-18(22-4)8-7-13-15-9-12(3)17(21)10-16(15)20-19(13)14/h5,7-10,20-21H,6H2,1-4H3 |
| InChI Key | XFLPKTCBCLWABD-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.157228913 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 5.30 |
| 107903-15-1 |
| 7-methoxy-3-methyl-8-(3-methylbut-2-enyl)-9H-carbazol-2-ol |
| Isomurrayafoline-B |
| NSC654280 |
| CHEMBL507794 |
| AKOS040763213 |
| NSC-654280 |
| NCI60_018844 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.77% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.15% | 91.49% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 94.06% | 89.62% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.95% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.66% | 91.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.20% | 98.95% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.14% | 95.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.09% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.79% | 86.92% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.73% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.05% | 97.21% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.59% | 91.79% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.89% | 96.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.73% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.72% | 94.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.63% | 98.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.25% | 98.59% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.10% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.06% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.76% | 90.20% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.27% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.20% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.79% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.21% | 90.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.01% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Murraya euchrestifolia |
| Murraya koenigii |
| PubChem | 375146 |
| NPASS | NPC243834 |
| ChEMBL | CHEMBL507794 |
| LOTUS | LTS0234212 |
| wikiData | Q104398705 |