7-Methoxy-2,4,11-trioxatricyclo[7.3.1.05,10]trideca-1(13),5(10),6,8-tetraen-12-one
| Internal ID | 4d86274c-b29d-4298-8132-6b047d2df253 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7-methoxy-2,4,11-trioxatricyclo[7.3.1.05,10]trideca-1(13),5(10),6,8-tetraen-12-one |
| SMILES (Canonical) | COC1=CC2=C3C(=C1)C=C(C(=O)O3)OCO2 |
| SMILES (Isomeric) | COC1=CC2=C3C(=C1)C=C(C(=O)O3)OCO2 |
| InChI | InChI=1S/C11H8O5/c1-13-7-2-6-3-9-11(12)16-10(6)8(4-7)14-5-15-9/h2-4H,5H2,1H3 |
| InChI Key | NVIUHDMTXPRPCU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 7-Methoxy-2,4,11-trioxatricyclo[7.3.1.05,10]trideca-1(13),5(10),6,8-tetraen-12-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-methoxy-2411-trioxatricyclo7310510trideca-11351068-tetraen-12-one.jpg "2D Structure of 7-Methoxy-2,4,11-trioxatricyclo[7.3.1.05,10]trideca-1(13),5(10),6,8-tetraen-12-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.61% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.59% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.12% | 93.99% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.03% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.29% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.02% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.93% | 96.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.70% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.04% | 94.80% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.86% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.24% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.99% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.89% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.36% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia vulgaris |
| PubChem | 163189849 |
| LOTUS | LTS0159606 |
| wikiData | Q105186256 |