7-Methoxy-2,2-dimethyl-pyrano[3,2-g]chromen-8-one
| Internal ID | 733c26bd-be28-4a39-bd45-7732691e3401 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Linear pyranocoumarins |
| IUPAC Name | 7-methoxy-2,2-dimethylpyrano[3,2-g]chromen-8-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H14O4/c1-15(2)5-4-9-6-10-7-13(17-3)14(16)18-11(10)8-12(9)19-15/h4-8H,1-3H3 |
| InChI Key | JVLPIRMUUSKKDG-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 7-Methoxy-2,2-dimethyl-pyrano[3,2-g]chromen-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-methoxy-22-dimethyl-pyrano32-gchromen-8-one.jpg "2D Structure of 7-Methoxy-2,2-dimethyl-pyrano[3,2-g]chromen-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.24% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.92% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.11% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.05% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.30% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.94% | 96.77% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.87% | 85.30% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.86% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.48% | 90.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.41% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.31% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ficus nervosa |
| PubChem | 155925067 |
| LOTUS | LTS0069902 |
| wikiData | Q105135830 |