7-Methoxy-2-phenyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,5-diol
| Internal ID | e67a7bfd-9b86-470e-8e1a-b9bc28eaec42 |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 7-methoxy-2-phenyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,5-diol |
| SMILES (Canonical) | CC(=C)C1CC2=C(C=C(C=C2O)OC)C(C1C3=CC=CC=C3)O |
| SMILES (Isomeric) | CC(=C)C1CC2=C(C=C(C=C2O)OC)C(C1C3=CC=CC=C3)O |
| InChI | InChI=1S/C20H22O3/c1-12(2)15-11-16-17(9-14(23-3)10-18(16)21)20(22)19(15)13-7-5-4-6-8-13/h4-10,15,19-22H,1,11H2,2-3H3 |
| InChI Key | OGWAQMQGHCSXMO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.65% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.43% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.87% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.34% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.75% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.57% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.12% | 85.14% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.09% | 91.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.49% | 94.08% |
| CHEMBL240 | Q12809 | HERG | 83.88% | 89.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.07% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.75% | 97.09% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.53% | 100.00% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 81.28% | 93.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carex distachya |
| PubChem | 162977193 |
| LOTUS | LTS0018544 |
| wikiData | Q105191894 |