7-Methoxy-2-(6-methoxy-1,3-benzodioxol-5-yl)chromen-4-one
| Internal ID | 716d5fed-ad59-4a5c-8d5a-c5a57c9e702b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 7-methoxy-2-(6-methoxy-1,3-benzodioxol-5-yl)chromen-4-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C(=O)C=C(O2)C3=CC4=C(C=C3OC)OCO4 |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C(=O)C=C(O2)C3=CC4=C(C=C3OC)OCO4 |
| InChI | InChI=1S/C18H14O6/c1-20-10-3-4-11-13(19)7-16(24-15(11)5-10)12-6-17-18(23-9-22-17)8-14(12)21-2/h3-8H,9H2,1-2H3 |
| InChI Key | BZEQTEZFGOLOLB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.42% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.80% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.77% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.19% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.03% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.16% | 92.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.25% | 93.31% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.59% | 85.30% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.23% | 94.80% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.95% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.59% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.36% | 93.99% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.33% | 97.36% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 85.06% | 92.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.87% | 86.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.85% | 96.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.65% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.50% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.86% | 97.09% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.74% | 92.38% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.95% | 96.86% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.42% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia erythrocalyx |
| PubChem | 11131197 |
| LOTUS | LTS0264443 |
| wikiData | Q104950428 |