7-Methoxy-11,11-dimethyl-4b,5,10,10a-tetrahydrobenzo[b]fluorene-5,9-diol
| Internal ID | f479af5c-8fa2-405d-9b6d-83a4cb17a8dd |
| Taxonomy | Benzenoids > Fluorenes |
| IUPAC Name | 7-methoxy-11,11-dimethyl-4b,5,10,10a-tetrahydrobenzo[b]fluorene-5,9-diol |
| SMILES (Canonical) | CC1(C2CC3=C(C=C(C=C3O)OC)C(C2C4=CC=CC=C41)O)C |
| SMILES (Isomeric) | CC1(C2CC3=C(C=C(C=C3O)OC)C(C2C4=CC=CC=C41)O)C |
| InChI | InChI=1S/C20H22O3/c1-20(2)15-7-5-4-6-12(15)18-16(20)10-13-14(19(18)22)8-11(23-3)9-17(13)21/h4-9,16,18-19,21-22H,10H2,1-3H3 |
| InChI Key | YCWYOWUFZQMEJP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of 7-Methoxy-11,11-dimethyl-4b,5,10,10a-tetrahydrobenzo[b]fluorene-5,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/7-methoxy-1111-dimethyl-4b51010a-tetrahydrobenzobfluorene-59-diol.jpg "2D Structure of 7-Methoxy-11,11-dimethyl-4b,5,10,10a-tetrahydrobenzo[b]fluorene-5,9-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 98.97% | 89.76% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.00% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.54% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.51% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.35% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.35% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.01% | 93.40% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.84% | 99.15% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.51% | 92.68% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.32% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.04% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.30% | 94.45% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.10% | 91.07% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 81.67% | 93.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium sativum |
| Carex distachya |
| PubChem | 163029574 |
| LOTUS | LTS0074654 |
| wikiData | Q105026820 |