7-Methoxy-1-methyl-1,2,3,4-tetrahydro-naphthalene
| Internal ID | 2379cd75-af0a-4fe1-9ae2-7762ee30db84 |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | 7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES (Canonical) | CC1CCCC2=C1C=C(C=C2)OC |
| SMILES (Isomeric) | CC1CCCC2=C1C=C(C=C2)OC |
| InChI | InChI=1S/C12H16O/c1-9-4-3-5-10-6-7-11(13-2)8-12(9)10/h6-9H,3-5H2,1-2H3 |
| InChI Key | KSWPMXHTZCMXBJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.25 g/mol |
| Exact Mass | 176.120115130 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 3.60 |
| KSWPMXHTZCMXBJ-UHFFFAOYSA-N |
| DTXSID101239572 |
| 1,2,3,4-Tetrahydro-7-methoxy-1-methylnaphthalene |
| 7-methoxy-1-methyl-1,2,3,4-tetrahydro-naphthalene |
| 1201-39-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.00% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.63% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.96% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.36% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.08% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.91% | 91.49% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.58% | 99.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.16% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.13% | 93.18% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.28% | 93.31% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.12% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.94% | 98.95% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.68% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.56% | 90.00% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 83.31% | 91.43% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.12% | 86.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.70% | 95.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.81% | 99.17% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.49% | 88.48% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.38% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Grindelia hirsutula |
| PubChem | 21636716 |
| LOTUS | LTS0187005 |
| wikiData | Q105145620 |