7-Hydroxy-beta-carboline-1-propionic acid
| Internal ID | e01ae5e3-ec60-48e9-b9f1-15ba42c45f29 |
| Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
| IUPAC Name | 3-(7-oxo-2,9-dihydropyrido[3,4-b]indol-1-yl)propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H12N2O3/c17-8-1-2-9-10-5-6-15-11(3-4-13(18)19)14(10)16-12(9)7-8/h1-2,5-7,15-16H,3-4H2,(H,18,19) |
| InChI Key | MBOPWGSKAKJDIH-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08479225 g/mol |
| Topological Polar Surface Area (TPSA) | 78.40 Ų |
| XlogP | 0.10 |
| 215934-15-9 |
| 3-(7-oxo-2,9-dihydropyrido[3,4-b]indol-1-yl)propanoic acid |
| CHEMBL5219042 |
| AKOS040735330 |
| FS-7582 |
| 3-(7-hydroxy-9h-beta-carboline-1-yl)propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.33% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.83% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.97% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.64% | 91.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.36% | 98.59% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 91.39% | 97.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.39% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.10% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.11% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.37% | 91.49% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.41% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.07% | 86.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.97% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.70% | 89.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.53% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10868897 |
| LOTUS | LTS0107629 |
| wikiData | Q77572159 |