7-Hydroxy-6-methoxy-4h-chromene
| Internal ID | 284d1a79-d00d-4dbd-8bc7-32f15db590d1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | 6-methoxy-4H-chromen-7-ol |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)CC=CO2)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)CC=CO2)O |
| InChI | InChI=1S/C10H10O3/c1-12-10-5-7-3-2-4-13-9(7)6-8(10)11/h2,4-6,11H,3H2,1H3 |
| InChI Key | YXDPSLZCSQBRGS-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 1.90 |
| 7-hydroxy-6-methoxy-4h-chromene |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.06% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.99% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.79% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.25% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.24% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.20% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.09% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.19% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.18% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.75% | 90.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.30% | 82.67% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.20% | 93.99% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.13% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Wisteria sinensis |
| PubChem | 11206106 |
| LOTUS | LTS0137295 |
| wikiData | Q105367509 |