(7-Hydroxy-5-methoxy-2,2-dimethylchromen-6-yl)-(4-hydroxy-3-methoxyphenyl)methanone
| Internal ID | 563e6cb9-093c-4e13-9460-1487a78cf93c |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
| IUPAC Name | (7-hydroxy-5-methoxy-2,2-dimethylchromen-6-yl)-(4-hydroxy-3-methoxyphenyl)methanone |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=C(C(=C2OC)C(=O)C3=CC(=C(C=C3)O)OC)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C(C(=C2OC)C(=O)C3=CC(=C(C=C3)O)OC)O)C |
| InChI | InChI=1S/C20H20O6/c1-20(2)8-7-12-15(26-20)10-14(22)17(19(12)25-4)18(23)11-5-6-13(21)16(9-11)24-3/h5-10,21-22H,1-4H3 |
| InChI Key | RNYNDGYJDSVNNS-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.13% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.87% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.15% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.76% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.33% | 90.20% |
| CHEMBL3194 | P02766 | Transthyretin | 89.10% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.99% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.46% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.89% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.43% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.08% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.70% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.68% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia buchananii |
| PubChem | 101911496 |
| LOTUS | LTS0070865 |
| wikiData | Q105241920 |