7-Hydroxy-4-methoxy-2,3-methylenedioxyphenanthrene
| Internal ID | f5b02fe4-f783-473b-bf81-8fba5bc854d8 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 11-methoxynaphtho[2,1-f][1,3]benzodioxol-3-ol |
| SMILES (Canonical) | COC1=C2C(=CC3=C1OCO3)C=CC4=C2C=CC(=C4)O |
| SMILES (Isomeric) | COC1=C2C(=CC3=C1OCO3)C=CC4=C2C=CC(=C4)O |
| InChI | InChI=1S/C16H12O4/c1-18-16-14-10(7-13-15(16)20-8-19-13)3-2-9-6-11(17)4-5-12(9)14/h2-7,17H,8H2,1H3 |
| InChI Key | NRGMJPPJGVPKQA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.88% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.54% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.88% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.10% | 96.77% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 86.24% | 93.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.17% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.73% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.51% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.53% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.86% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.85% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.35% | 90.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.58% | 98.35% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.50% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.48% | 99.17% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.99% | 82.67% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 80.93% | 94.70% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum andersonii |
| PubChem | 14524524 |
| LOTUS | LTS0206502 |
| wikiData | Q105184537 |