7-Hydroxy-3,5,6,3',4'-pentamethoxyflavone
| Internal ID | 3974c9c6-6aa8-4800-ac2d-317caef75d81 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 6-O-methylated flavonoids |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-7-hydroxy-3,5,6-trimethoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3OC)OC)O)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3OC)OC)O)OC)OC |
| InChI | InChI=1S/C20H20O8/c1-23-12-7-6-10(8-13(12)24-2)17-20(27-5)16(22)15-14(28-17)9-11(21)18(25-3)19(15)26-4/h6-9,21H,1-5H3 |
| InChI Key | DFMQEEUDLFLPFL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 92.70 Ų |
| XlogP | 2.90 |
| Quercetagetin 3,5,6,3',4'-pentamethyl ether |
| 7-hydroxy-3,3',4',5,6-pentamethoxyflavone |
| SCHEMBL1764647 |
| LMPK12113016 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.13% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.27% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.79% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.03% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.51% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.13% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.51% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.39% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.29% | 90.20% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.43% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.96% | 99.17% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.03% | 98.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.78% | 96.09% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.53% | 85.00% |
| CHEMBL3194 | P02766 | Transthyretin | 80.93% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ambrosia grayi |
| PubChem | 9843255 |
| LOTUS | LTS0192681 |
| wikiData | Q104978008 |