7-Hydroxy-3-methoxy-4-methylindeno[1,2-b]pyridin-5-one
| Internal ID | 6d0e987b-f247-41de-bb71-907140b828b6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones |
| IUPAC Name | 7-hydroxy-3-methoxy-4-methylindeno[1,2-b]pyridin-5-one |
| SMILES (Canonical) | CC1=C2C(=NC=C1OC)C3=C(C2=O)C=C(C=C3)O |
| SMILES (Isomeric) | CC1=C2C(=NC=C1OC)C3=C(C2=O)C=C(C=C3)O |
| InChI | InChI=1S/C14H11NO3/c1-7-11(18-2)6-15-13-9-4-3-8(16)5-10(9)14(17)12(7)13/h3-6,16H,1-2H3 |
| InChI Key | ULCNJNHJPIWQCU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 59.40 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 7-Hydroxy-3-methoxy-4-methylindeno[1,2-b]pyridin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-hydroxy-3-methoxy-4-methylindeno12-bpyridin-5-one.jpg "2D Structure of 7-Hydroxy-3-methoxy-4-methylindeno[1,2-b]pyridin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.36% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.09% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.59% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.74% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.61% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 90.27% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.49% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.32% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.34% | 89.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.07% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.03% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.94% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.07% | 96.09% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 84.64% | 91.23% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.52% | 99.23% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.30% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.28% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.59% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.57% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piptostigma fugax |
| PubChem | 135519049 |
| LOTUS | LTS0028768 |
| wikiData | Q105275014 |