7-hydroxy-3-(2-hydroxy-6-methylphenyl)-7-methyl-8-(3-methyl-2-oxononyl)-8H-isochromen-6-one
| Internal ID | 9ebb2b66-68b6-4cc4-b3d7-a3be7c062c79 |
| Taxonomy | Benzenoids > Phenols > Cresols > Meta cresols |
| IUPAC Name | 7-hydroxy-3-(2-hydroxy-6-methylphenyl)-7-methyl-8-(3-methyl-2-oxononyl)-8H-isochromen-6-one |
| SMILES (Canonical) | CCCCCCC(C)C(=O)CC1C2=COC(=CC2=CC(=O)C1(C)O)C3=C(C=CC=C3O)C |
| SMILES (Isomeric) | CCCCCCC(C)C(=O)CC1C2=COC(=CC2=CC(=O)C1(C)O)C3=C(C=CC=C3O)C |
| InChI | InChI=1S/C27H34O5/c1-5-6-7-8-10-17(2)23(29)15-21-20-16-32-24(26-18(3)11-9-12-22(26)28)13-19(20)14-25(30)27(21,4)31/h9,11-14,16-17,21,28,31H,5-8,10,15H2,1-4H3 |
| InChI Key | BYXAPCXRCDLMIZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.24062418 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.65% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.00% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.01% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.52% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.87% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.91% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.35% | 94.73% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.08% | 97.79% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.32% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.58% | 93.31% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.19% | 96.47% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.08% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.08% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.63% | 99.23% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.04% | 93.18% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.94% | 97.29% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.64% | 89.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.56% | 94.80% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.71% | 85.94% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.35% | 93.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.68% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.64% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 80.47% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163087502 |
| LOTUS | LTS0078165 |
| wikiData | Q103817161 |