7-Hydroxy-2,6,11,11-tetramethyl-8-oxatricyclo[7.3.0.02,5]dodec-5-en-4-one
| Internal ID | a24ca701-201b-4aaa-97f7-bcd1097bc3c4 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Hemiacetals |
| IUPAC Name | 7-hydroxy-2,6,11,11-tetramethyl-8-oxatricyclo[7.3.0.02,5]dodec-5-en-4-one |
| SMILES (Canonical) | CC1=C2C(=O)CC2(C3CC(CC3OC1O)(C)C)C |
| SMILES (Isomeric) | CC1=C2C(=O)CC2(C3CC(CC3OC1O)(C)C)C |
| InChI | InChI=1S/C15H22O3/c1-8-12-10(16)6-15(12,4)9-5-14(2,3)7-11(9)18-13(8)17/h9,11,13,17H,5-7H2,1-4H3 |
| InChI Key | UJUDUTPSCRULOQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.45% | 96.77% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.40% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.55% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.68% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.87% | 95.56% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.60% | 97.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.43% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.09% | 90.17% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.67% | 95.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.73% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.03% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.76% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.58% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.77% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.72% | 94.45% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.33% | 93.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.01% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 118440086 |
| LOTUS | LTS0094474 |
| wikiData | Q104198292 |