7-Hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one
Internal ID | eee3e0e7-91af-4036-901a-2a6f4aac5f1a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | 7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)C |
InChI | InChI=1S/C20H20O4/c1-12(2)3-8-15-17(22)10-9-16-18(23)11-19(24-20(15)16)13-4-6-14(21)7-5-13/h3-7,9-10,19,21-22H,8,11H2,1-2H3 |
InChI Key | KYFBXCHUXFKMGQ-UHFFFAOYSA-N |
Popularity | 15 references in papers |
Molecular Formula | C20H20O4 |
Molecular Weight | 324.40 g/mol |
Exact Mass | 324.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 4.10 |
24672-86-4 |
SCHEMBL1170628 |
4',7-dihydroxy-8-prenylflavanone |
LMPK12140036 |
AKOS032948697 |
FT-0689399 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.75% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.27% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.63% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.45% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.88% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.31% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.96% | 98.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.44% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.44% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.30% | 99.23% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.99% | 85.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.79% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica keiskei |
Brosimum acutifolium |
Erythrina sigmoidea |
Glycyrrhiza pallidiflora |
Lespedeza cyrtobotrya |
Sophora alopecuroides |
Sophora flavescens |
PubChem | 11609510 |
LOTUS | LTS0203290 |
wikiData | Q105147691 |