7-Hydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | aff11e24-36e9-4e58-8a7d-27f081b55453 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 7-hydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C21H20O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-12-4-1-10(2-5-12)15-8-14(24)13-6-3-11(23)7-16(13)29-15/h1-8,17-23,25-27H,9H2 |
InChI Key | GSZUGBAEBARHAW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O9 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of 7-Hydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one 2D Structure of 7-Hydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-hydroxy-2-4-345-trihydroxy-6-hydroxymethyloxan-2-yloxyphenylchromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 99.34% | 83.57% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.67% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.38% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.22% | 98.95% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 94.19% | 98.35% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.21% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.26% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.83% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.72% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.68% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.27% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.65% | 95.89% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.08% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.07% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.69% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.69% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.08% | 95.89% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.65% | 95.53% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.22% | 95.78% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.66% | 96.37% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.33% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 80.12% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetradium glabrifolium |
PubChem | 74977405 |
LOTUS | LTS0159600 |
wikiData | Q105018325 |