7-Hydroxy-2-(1-hydroxy-1-methyl-ethyl)-2,3-dihydrofuro[3,2-c]xanthen-6-one
| Internal ID | a017c8e9-a57e-42bb-8433-eaf50c4c885b |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 7-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydrofuro[3,2-c]xanthen-6-one |
| SMILES (Canonical) | CC(C)(C1CC2=C(O1)C3=C(C=C2)C(=O)C4=C(C=CC=C4O3)O)O |
| SMILES (Isomeric) | CC(C)(C1CC2=C(O1)C3=C(C=C2)C(=O)C4=C(C=CC=C4O3)O)O |
| InChI | InChI=1S/C18H16O5/c1-18(2,21)13-8-9-6-7-10-15(20)14-11(19)4-3-5-12(14)22-17(10)16(9)23-13/h3-7,13,19,21H,8H2,1-2H3 |
| InChI Key | AUACLMGLHMJOTC-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.20 |
| 7-hydroxy-2-(1-hydroxy-1-methyl-ethyl)-2,3-dihydrofuro[3,2-c]xanthen-6-one |
![2D Structure of 7-Hydroxy-2-(1-hydroxy-1-methyl-ethyl)-2,3-dihydrofuro[3,2-c]xanthen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-hydroxy-2-1-hydroxy-1-methyl-ethyl-23-dihydrofuro32-cxanthen-6-one.jpg "2D Structure of 7-Hydroxy-2-(1-hydroxy-1-methyl-ethyl)-2,3-dihydrofuro[3,2-c]xanthen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.98% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.90% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.20% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.09% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.88% | 95.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.15% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.76% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.68% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.14% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.29% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.17% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.64% | 96.39% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.34% | 93.65% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.59% | 97.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.91% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calophyllum austroindicum |
| Calophyllum caledonicum |
| PubChem | 5464637 |
| LOTUS | LTS0047588 |
| wikiData | Q104918781 |