7-Hexylicosane
Internal ID | f385ce1d-d87f-4558-bf2b-666cdd7a1d89 |
Taxonomy | Hydrocarbons > Saturated hydrocarbons > Alkanes > Branched alkanes |
IUPAC Name | 7-hexylicosane |
SMILES (Canonical) | CCCCCCCCCCCCCC(CCCCCC)CCCCCC |
SMILES (Isomeric) | CCCCCCCCCCCCCC(CCCCCC)CCCCCC |
InChI | InChI=1S/C26H54/c1-4-7-10-13-14-15-16-17-18-19-22-25-26(23-20-11-8-5-2)24-21-12-9-6-3/h26H,4-25H2,1-3H3 |
InChI Key | JRLUJYJPNVXXKS-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C26H54 |
Molecular Weight | 366.70 g/mol |
Exact Mass | 366.422551722 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 14.00 |
Eicosane, 7-hexyl- |
7-n-Hexyleicosane |
55333-99-8 |
7-hexyleicosane |
7-Hexylicosane # |
NSC157988 |
DTXSID30303359 |
JRLUJYJPNVXXKS-UHFFFAOYSA-N |
NSC-157988 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.94% | 92.86% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.15% | 89.63% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.53% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.05% | 92.08% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.04% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 92.53% | 98.95% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.86% | 91.81% |
CHEMBL1907 | P15144 | Aminopeptidase N | 90.34% | 93.31% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.35% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.35% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.80% | 99.17% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.48% | 87.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.30% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.00% | 93.56% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.72% | 98.03% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.06% | 90.24% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.61% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.32% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio cerberoanus |
PubChem | 292289 |
LOTUS | LTS0059070 |
wikiData | Q82048592 |