7-Ethenyl-4b,7,10a-trimethyl-1-methylidene-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,6-diol
| Internal ID | b502fc8c-ca3f-49c5-911d-36b1665790b4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | 7-ethenyl-4b,7,10a-trimethyl-1-methylidene-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,6-diol |
| SMILES (Canonical) | CC12CCC3CC(C(CC3(C1CCC(C2=C)O)C)O)(C)C=C |
| SMILES (Isomeric) | CC12CCC3CC(C(CC3(C1CCC(C2=C)O)C)O)(C)C=C |
| InChI | InChI=1S/C20H32O2/c1-6-18(3)11-14-9-10-19(4)13(2)15(21)7-8-16(19)20(14,5)12-17(18)22/h6,14-17,21-22H,1-2,7-12H2,3-5H3 |
| InChI Key | SEWWRXQGNOQVSS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.53% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.77% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.68% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.49% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.14% | 96.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.18% | 95.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 84.41% | 99.43% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.46% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.22% | 97.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.53% | 92.86% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.40% | 95.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.77% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Givotia madagascariensis |
| PubChem | 72833922 |
| LOTUS | LTS0078555 |
| wikiData | Q105251585 |