7-Deoxy-desulfo-cylindrospermopsin
Internal ID | 36674304-04e0-4ec0-aa6c-4cbae4264632 |
Taxonomy | Organoheterocyclic compounds > Pyridopyrimidines |
IUPAC Name | 6-[[(4S,5R,6S,8S,10R)-6-hydroxy-5-methyl-2,11,12-triazatricyclo[6.3.1.04,12]dodec-1-en-10-yl]methyl]-1H-pyrimidine-2,4-dione |
SMILES (Canonical) | CC1C(CC2CC(NC3=NCC1N23)CC4=CC(=O)NC(=O)N4)O |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@@H]2C[C@@H](NC3=NC[C@H]1N23)CC4=CC(=O)NC(=O)N4)O |
InChI | InChI=1S/C15H21N5O3/c1-7-11-6-16-14-17-8(3-10(20(11)14)5-12(7)21)2-9-4-13(22)19-15(23)18-9/h4,7-8,10-12,21H,2-3,5-6H2,1H3,(H,16,17)(H2,18,19,22,23)/t7-,8+,10+,11-,12+/m1/s1 |
InChI Key | HKUZFYRVEQYWCO-GATYQTQLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H21N5O3 |
Molecular Weight | 319.36 g/mol |
Exact Mass | 319.16443955 g/mol |
Topological Polar Surface Area (TPSA) | 106.00 Ų |
XlogP | -1.10 |
DTXSID001335214 |
1644631-81-1 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.71% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.01% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.19% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.59% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.11% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.07% | 90.71% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.72% | 98.59% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.04% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.99% | 82.69% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.86% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.19% | 90.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.99% | 89.34% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.91% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buxus papillosa |
PubChem | 11247498 |
LOTUS | LTS0129025 |
wikiData | Q105179440 |