Bauerine A
| Internal ID | 140ad819-754b-4e01-bca1-f3ec4f3e1884 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 7-chloro-9-methylpyrido[3,4-b]indole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H9ClN2/c1-15-11-6-8(13)2-3-9(11)10-4-5-14-7-12(10)15/h2-7H,1H3 |
| InChI Key | CRAMILMCKLDURA-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.0454260 g/mol |
| Topological Polar Surface Area (TPSA) | 17.80 Ų |
| XlogP | 2.90 |
| 7-Chloro-9-methyl-9H-pyrido(3,4-b)indole |
| 156312-09-3 |
| 7-chloro-9-methylpyrido[3,4-b]indole |
| CHEMBL447248 |
| DTXSID80166077 |
| 9H-Pyrido(3,4-b)indole, 7-chloro-9-methyl- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 97.10% | 93.24% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.11% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.02% | 94.45% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 92.56% | 100.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.26% | 85.30% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.52% | 98.59% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.14% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.37% | 86.33% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 88.04% | 80.71% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.57% | 92.29% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.04% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.32% | 90.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.27% | 86.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.02% | 94.73% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 84.43% | 97.98% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.24% | 96.00% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 84.24% | 99.09% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 84.19% | 99.23% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.02% | 85.94% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.19% | 90.24% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.89% | 89.62% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.60% | 92.68% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.58% | 97.36% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 81.13% | 92.86% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 80.74% | 90.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.67% | 98.95% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 80.31% | 95.52% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 189885 |
| LOTUS | LTS0201862 |
| wikiData | Q75065325 |