7-Aminocycloheptane-1,2,4-triol
| Internal ID | 042a7e03-383b-4d46-bca3-db95c69c0c24 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclitols and derivatives |
| IUPAC Name | 7-aminocycloheptane-1,2,4-triol |
| SMILES (Canonical) | C1CC(C(C(CC1O)O)O)N |
| SMILES (Isomeric) | C1CC(C(C(CC1O)O)O)N |
| InChI | InChI=1S/C7H15NO3/c8-5-2-1-4(9)3-6(10)7(5)11/h4-7,9-11H,1-3,8H2 |
| InChI Key | SKJGTWUZWAKYCQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 86.70 Ų |
| XlogP | -1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.61% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.95% | 95.93% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.39% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.99% | 96.09% |
| CHEMBL5331 | Q12866 | Proto-oncogene tyrosine-protein kinase MER | 80.58% | 91.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.10% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Physalis minima |
| PubChem | 129996116 |
| LOTUS | LTS0216625 |
| wikiData | Q105254861 |