7-(5-Hydroxy-4-methoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol
Internal ID | 4d8ca02f-24ea-4963-9764-71e84b1abd05 |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
IUPAC Name | 7-(5-hydroxy-4-methoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
SMILES (Canonical) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)O)O |
SMILES (Isomeric) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)O)O |
InChI | InChI=1S/C23H25NO3/c1-12-10-19(27-4)22-16(6-5-7-18(22)25)20(12)17-9-8-15-11-13(2)24-14(3)21(15)23(17)26/h5-10,13-14,24-26H,11H2,1-4H3 |
InChI Key | PBUONONRMDRRLQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H25NO3 |
Molecular Weight | 363.40 g/mol |
Exact Mass | 363.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 4.70 |
There are no found synonyms. |
![2D Structure of 7-(5-Hydroxy-4-methoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol 2D Structure of 7-(5-Hydroxy-4-methoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol](https://plantaedb.com/storage/docs/compounds/2023/11/7-5-hydroxy-4-methoxy-2-methylnaphthalen-1-yl-13-dimethyl-1234-tetrahydroisoquinolin-8-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.96% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.49% | 95.56% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.64% | 91.79% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.24% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.29% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.18% | 92.94% |
CHEMBL1907 | P15144 | Aminopeptidase N | 91.73% | 93.31% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.01% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.71% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 90.22% | 98.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.29% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.10% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.49% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.30% | 96.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.99% | 95.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.79% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.57% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.52% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.34% | 99.17% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.09% | 97.31% |
CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 83.80% | 89.76% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.46% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.76% | 94.45% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.67% | 95.56% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.39% | 90.24% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.17% | 91.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.10% | 94.03% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.71% | 96.39% |
CHEMBL5028 | O14672 | ADAM10 | 80.30% | 97.50% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.15% | 100.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.01% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioncophyllum thollonii |
PubChem | 85127983 |
LOTUS | LTS0178117 |
wikiData | Q105205463 |