7-(5-Decyloxolan-2-YL)heptane-1,4-diol
Internal ID | b54cb66d-c46b-4757-9f3e-31f762c9021c |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
IUPAC Name | 7-(5-decyloxolan-2-yl)heptane-1,4-diol |
SMILES (Canonical) | CCCCCCCCCCC1CCC(O1)CCCC(CCCO)O |
SMILES (Isomeric) | CCCCCCCCCCC1CCC(O1)CCCC(CCCO)O |
InChI | InChI=1S/C21H42O3/c1-2-3-4-5-6-7-8-9-14-20-16-17-21(24-20)15-10-12-19(23)13-11-18-22/h19-23H,2-18H2,1H3 |
InChI Key | HWPCQGCANKCDOP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H42O3 |
Molecular Weight | 342.60 g/mol |
Exact Mass | 342.31339520 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 6.20 |
7-(5-DECYLOXOLAN-2-YL)HEPTANE-1,4-DIOL |
SCHEMBL3889919 |
DTXSID30739119 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.78% | 97.29% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.59% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.49% | 97.25% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.28% | 92.86% |
CHEMBL2581 | P07339 | Cathepsin D | 95.22% | 98.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.32% | 100.00% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 90.44% | 90.24% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.36% | 97.79% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.93% | 91.11% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 89.42% | 87.45% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.22% | 91.81% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.84% | 99.17% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.68% | 93.18% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.33% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.92% | 95.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.15% | 96.61% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.64% | 89.63% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.11% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.12% | 92.08% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.90% | 98.03% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.29% | 98.10% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.15% | 83.82% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.56% | 100.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.53% | 92.88% |
CHEMBL260 | Q16539 | MAP kinase p38 alpha | 81.26% | 97.78% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.92% | 98.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.89% | 92.62% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.88% | 96.47% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.17% | 89.05% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.12% | 95.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chlorophytum arundinaceum |
PubChem | 68828042 |
LOTUS | LTS0167956 |
wikiData | Q82684743 |