7-(4-Hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone
Internal ID | 58a902cf-a712-45c8-9357-ea3333ba40c5 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 7-(4-hydroxy-3-methoxyphenyl)-5-methoxy-1-phenylheptan-3-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)CCC(CC(=O)CCC2=CC=CC=C2)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CCC(CC(=O)CCC2=CC=CC=C2)OC)O |
InChI | InChI=1S/C21H26O4/c1-24-19(12-9-17-10-13-20(23)21(14-17)25-2)15-18(22)11-8-16-6-4-3-5-7-16/h3-7,10,13-14,19,23H,8-9,11-12,15H2,1-2H3 |
InChI Key | XYIISUAVSYEQLI-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H26O4 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 3.60 |
3-Heptanone, 7-(4-hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl- |
7-(4-hydroxy-3-methoxyphenyl)-5-methoxy-1-phenylheptan-3-one |
Tylophorine (8CI) |
7-(4-Hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone |
SCHEMBL6378341 |
DTXSID00415751 |
AKOS040763416 |
2,3,6,7-Tetramethoxyphenanthro[9,10:6',7']indolizidine |
5-methoxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl-3-heptanone |
7-(4-Hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone, 9CI |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.23% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.26% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.28% | 90.20% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.47% | 95.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.96% | 95.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.71% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.50% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 91.00% | 98.75% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.45% | 100.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.91% | 93.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.51% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.80% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia officinarum |
PubChem | 5319454 |
LOTUS | LTS0189151 |
wikiData | Q82224729 |