7-(3,7-Dimethylocta-2,6-dienyl)-5,6-dihydroxy-3-[(4-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one
| Internal ID | 24b2d058-3f74-4f04-8c81-4633f58eef31 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienyl)-5,6-dihydroxy-3-[(4-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC(=CCCC(=CCC1=CC2=C(C(=O)C(CO2)CC3=CC=C(C=C3)O)C(=C1O)O)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CCC1=CC2=C(C(=O)C(CO2)CC3=CC=C(C=C3)O)C(=C1O)O)C)C |
| InChI | InChI=1S/C26H30O5/c1-16(2)5-4-6-17(3)7-10-19-14-22-23(26(30)25(19)29)24(28)20(15-31-22)13-18-8-11-21(27)12-9-18/h5,7-9,11-12,14,20,27,29-30H,4,6,10,13,15H2,1-3H3 |
| InChI Key | FNWRLQHMHZHIHB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
![2D Structure of 7-(3,7-Dimethylocta-2,6-dienyl)-5,6-dihydroxy-3-[(4-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-37-dimethylocta-26-dienyl-56-dihydroxy-3-4-hydroxyphenylmethyl-23-dihydrochromen-4-one.jpg "2D Structure of 7-(3,7-Dimethylocta-2,6-dienyl)-5,6-dihydroxy-3-[(4-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.14% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.36% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.80% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.85% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.83% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.45% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.31% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.28% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.00% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.87% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.69% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.81% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.47% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.42% | 96.09% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.77% | 85.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.59% | 92.08% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.53% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ledebouria floribunda |
| PubChem | 162936266 |
| LOTUS | LTS0068769 |
| wikiData | Q104998586 |