7-(3,7-Dimethylocta-2,6-dienyl)-1,5,6-trihydroxy-3-methoxyxanthen-9-one
| Internal ID | 6bf077f3-8a07-48d9-915f-014adb5945df |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienyl)-1,5,6-trihydroxy-3-methoxyxanthen-9-one |
| SMILES (Canonical) | CC(=CCCC(=CCC1=CC2=C(C(=C1O)O)OC3=CC(=CC(=C3C2=O)O)OC)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CCC1=CC2=C(C(=C1O)O)OC3=CC(=CC(=C3C2=O)O)OC)C)C |
| InChI | InChI=1S/C24H26O6/c1-13(2)6-5-7-14(3)8-9-15-10-17-22(27)20-18(25)11-16(29-4)12-19(20)30-24(17)23(28)21(15)26/h6,8,10-12,25-26,28H,5,7,9H2,1-4H3 |
| InChI Key | LYHLFIQYBMGNNX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.67% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.54% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.76% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.74% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.50% | 91.49% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.45% | 92.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.65% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.52% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.72% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.63% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.30% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.45% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.27% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.33% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.78% | 93.99% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.68% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.53% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia portoricensis |
| PubChem | 90918464 |
| LOTUS | LTS0122517 |
| wikiData | Q105159326 |