7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-2-(4-hydroxyphenyl)-5-methoxychromen-4-one
| Internal ID | abe40795-c61c-4129-9eee-886e2f2e95f1 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
| IUPAC Name | 7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-2-(4-hydroxyphenyl)-5-methoxychromen-4-one |
| SMILES (Canonical) | CC1(C(O1)COC2=CC3=C(C(=C2)OC)C(=O)C=C(O3)C4=CC=C(C=C4)O)C |
| SMILES (Isomeric) | CC1([C@H](O1)COC2=CC3=C(C(=C2)OC)C(=O)C=C(O3)C4=CC=C(C=C4)O)C |
| InChI | InChI=1S/C21H20O6/c1-21(2)19(27-21)11-25-14-8-17(24-3)20-15(23)10-16(26-18(20)9-14)12-4-6-13(22)7-5-12/h4-10,19,22H,11H2,1-3H3/t19-/m1/s1 |
| InChI Key | OBWXJUKMULORIR-LJQANCHMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 77.50 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.92% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.87% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.53% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.69% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.75% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.55% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.07% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.07% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.29% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.92% | 98.95% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.43% | 95.78% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.80% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.55% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.33% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.80% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.91% | 98.75% |
| CHEMBL3194 | P02766 | Transthyretin | 80.76% | 90.71% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.57% | 97.28% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.32% | 92.94% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.26% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.07% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achyrocline flaccida |
| PubChem | 163187011 |
| LOTUS | LTS0081276 |
| wikiData | Q105189195 |