7-[[(2E,6E)-5,8-Dihydroxy-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]oxy]-2H-1-benzopyran-2-one
Internal ID | 6a08e254-bc52-4449-bc95-9e72e945fd62 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 7-(5,8-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy)chromen-2-one |
SMILES (Canonical) | CC(=CCC(C(=CC(CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)O)C)O)C |
SMILES (Isomeric) | CC(=CCC(C(=CC(CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)O)C)O)C |
InChI | InChI=1S/C24H30O5/c1-16(2)5-9-22(26)18(4)14-20(25)13-17(3)11-12-28-21-8-6-19-7-10-24(27)29-23(19)15-21/h5-8,10-11,14-15,20,22,25-26H,9,12-13H2,1-4H3 |
InChI Key | NFXNEAJDYTXPLG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H30O5 |
Molecular Weight | 398.50 g/mol |
Exact Mass | 398.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 4.90 |
122617-02-1 |
7-[[(2E,6E)-5,8-Dihydroxy-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]oxy]-2H-1-benzopyran-2-one |
![2D Structure of 7-[[(2E,6E)-5,8-Dihydroxy-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]oxy]-2H-1-benzopyran-2-one 2D Structure of 7-[[(2E,6E)-5,8-Dihydroxy-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]oxy]-2H-1-benzopyran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-2e6e-58-dihydroxy-3711-trimethyl-2610-dodecatrien-1-yloxy-2h-1-benzopyran-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.12% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.37% | 99.17% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 95.83% | 92.51% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.11% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.47% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.46% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.12% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.94% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.34% | 91.49% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.11% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.47% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.05% | 86.33% |
CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 82.83% | 88.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.44% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.20% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula assa-foetida |
PubChem | 72729869 |
LOTUS | LTS0221493 |
wikiData | Q105178740 |