7-[(2E,5R,6E)-5,8-dihydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one
| Internal ID | d310d449-29b2-41c4-a62d-96a1d09c5991 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 7-[(2E,5R,6E)-5,8-dihydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
| SMILES (Canonical) | CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)CC(C=C(C)CO)O |
| SMILES (Isomeric) | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/C[C@H](/C=C(\C)/CO)O |
| InChI | InChI=1S/C19H22O5/c1-13(9-16(21)10-14(2)12-20)7-8-23-17-5-3-15-4-6-19(22)24-18(15)11-17/h3-7,10-11,16,20-21H,8-9,12H2,1-2H3/b13-7+,14-10+/t16-/m1/s1 |
| InChI Key | IMLYNABZONYGFI-ZEXFPZSPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 98.04% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.63% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.75% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.64% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.57% | 94.00% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 89.06% | 88.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.64% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.69% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.48% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.43% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.91% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.31% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.26% | 89.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.66% | 86.92% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.02% | 96.00% |
| CHEMBL4531 | P17931 | Galectin-3 | 80.63% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena excavata |
| PubChem | 163194264 |
| LOTUS | LTS0085061 |
| wikiData | Q105115758 |