7-(2-Methyloxolan-2-yl)-5-propan-2-ylhept-6-en-2-one
| Internal ID | bae99586-0924-43b1-b02d-786ad83e1c9c |
| Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
| IUPAC Name | 7-(2-methyloxolan-2-yl)-5-propan-2-ylhept-6-en-2-one |
| SMILES (Canonical) | CC(C)C(CCC(=O)C)C=CC1(CCCO1)C |
| SMILES (Isomeric) | CC(C)C(CCC(=O)C)C=CC1(CCCO1)C |
| InChI | InChI=1S/C15H26O2/c1-12(2)14(7-6-13(3)16)8-10-15(4)9-5-11-17-15/h8,10,12,14H,5-7,9,11H2,1-4H3 |
| InChI Key | GPNLVCAPXPSJQB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.193280068 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.97% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.51% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.22% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.24% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.43% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.19% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.08% | 85.14% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.50% | 89.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.40% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.37% | 98.03% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.32% | 98.75% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.56% | 99.35% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.52% | 96.77% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.22% | 93.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.63% | 93.10% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.04% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 85853885 |
| LOTUS | LTS0152073 |
| wikiData | Q105015017 |