7-(2-Methyloxolan-2-yl)-5-propan-2-ylhept-6-en-2-ol
Internal ID | 1a2fde4e-3e58-4331-9a71-a1dff91ff40e |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
IUPAC Name | 7-(2-methyloxolan-2-yl)-5-propan-2-ylhept-6-en-2-ol |
SMILES (Canonical) | CC(C)C(CCC(C)O)C=CC1(CCCO1)C |
SMILES (Isomeric) | CC(C)C(CCC(C)O)C=CC1(CCCO1)C |
InChI | InChI=1S/C15H28O2/c1-12(2)14(7-6-13(3)16)8-10-15(4)9-5-11-17-15/h8,10,12-14,16H,5-7,9,11H2,1-4H3 |
InChI Key | YOMJFGRYEWDLQO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H28O2 |
Molecular Weight | 240.38 g/mol |
Exact Mass | 240.208930132 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.93% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.93% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.24% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.84% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.95% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 85.51% | 98.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.40% | 89.50% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.63% | 98.75% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.60% | 98.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.10% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.50% | 93.56% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.79% | 97.56% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.59% | 93.10% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.42% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.08% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.02% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 85853886 |
LOTUS | LTS0072006 |
wikiData | Q105351392 |