7-(2-Isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene
| Internal ID | 2f8043f5-e992-471d-8445-dafeed88562d |
| Taxonomy | Organosulfur compounds > Isothiocyanates |
| IUPAC Name | 7-(2-isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES (Canonical) | CC1CCCC2C1=CC(CC2C)C(C)(C)N=C=S |
| SMILES (Isomeric) | CC1CCCC2C1=CC(CC2C)C(C)(C)N=C=S |
| InChI | InChI=1S/C16H25NS/c1-11-6-5-7-14-12(2)8-13(9-15(11)14)16(3,4)17-10-18/h9,11-14H,5-8H2,1-4H3 |
| InChI Key | UAAIUTCZMXLPPT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.17077098 g/mol |
| Topological Polar Surface Area (TPSA) | 44.40 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.17% | 97.25% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.43% | 97.23% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.34% | 83.57% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.00% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.71% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.48% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.73% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.09% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.07% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.62% | 97.14% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.41% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.85% | 95.89% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.49% | 95.58% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.36% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.03% | 95.56% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.65% | 97.05% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.39% | 96.43% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.02% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162873991 |
| LOTUS | LTS0206011 |
| wikiData | Q105268525 |