7-[(1R)-1-hydroxyethyl]-6-methoxy-3-propan-2-ylidene-1,4-benzodioxin-2-one
| Internal ID | 1e6fcf04-0480-4c75-8089-08806e6e6544 |
| Taxonomy | Organoheterocyclic compounds > Benzodioxanes > Benzo-1,4-dioxanes |
| IUPAC Name | 7-[(1R)-1-hydroxyethyl]-6-methoxy-3-propan-2-ylidene-1,4-benzodioxin-2-one |
| SMILES (Canonical) | CC(C1=CC2=C(C=C1OC)OC(=C(C)C)C(=O)O2)O |
| SMILES (Isomeric) | C[C@H](C1=CC2=C(C=C1OC)OC(=C(C)C)C(=O)O2)O |
| InChI | InChI=1S/C14H16O5/c1-7(2)13-14(16)19-11-5-9(8(3)15)10(17-4)6-12(11)18-13/h5-6,8,15H,1-4H3/t8-/m1/s1 |
| InChI Key | NIHCHRDUUOVOEE-MRVPVSSYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 7-[(1R)-1-hydroxyethyl]-6-methoxy-3-propan-2-ylidene-1,4-benzodioxin-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-1r-1-hydroxyethyl-6-methoxy-3-propan-2-ylidene-14-benzodioxin-2-one.jpg "2D Structure of 7-[(1R)-1-hydroxyethyl]-6-methoxy-3-propan-2-ylidene-1,4-benzodioxin-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.90% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.68% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.96% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.60% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.97% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.40% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.54% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.19% | 94.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.50% | 89.50% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.45% | 82.38% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.04% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.72% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.53% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.08% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.06% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calea harleyi |
| PubChem | 162967588 |
| LOTUS | LTS0094754 |
| wikiData | Q105179811 |