7-(1,3-Benzodioxol-5-yl)-5,10-dimethoxy-2,2-dimethylpyrano[3,2-g]chromen-6-one
| Internal ID | 5a683e5c-52ed-473c-bcd6-dd58a22a4790 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-5,10-dimethoxy-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C(=C3C(=C2OC)C(=O)C(=CO3)C4=CC5=C(C=C4)OCO5)OC)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C(=C3C(=C2OC)C(=O)C(=CO3)C4=CC5=C(C=C4)OCO5)OC)C |
| InChI | InChI=1S/C23H20O7/c1-23(2)8-7-13-19(25-3)17-18(24)14(10-27-21(17)22(26-4)20(13)30-23)12-5-6-15-16(9-12)29-11-28-15/h5-10H,11H2,1-4H3 |
| InChI Key | GAEOYWHVKRXNQF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 72.40 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of 7-(1,3-Benzodioxol-5-yl)-5,10-dimethoxy-2,2-dimethylpyrano[3,2-g]chromen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-13-benzodioxol-5-yl-510-dimethoxy-22-dimethylpyrano32-gchromen-6-one.jpg "2D Structure of 7-(1,3-Benzodioxol-5-yl)-5,10-dimethoxy-2,2-dimethylpyrano[3,2-g]chromen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.34% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.09% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.04% | 94.45% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 95.84% | 80.96% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.57% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.21% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 92.52% | 85.30% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.65% | 89.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.78% | 82.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.40% | 85.14% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.06% | 95.71% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.99% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.10% | 97.14% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.46% | 95.78% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.24% | 93.31% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 85.22% | 95.53% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.67% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.63% | 94.75% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 84.34% | 85.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.08% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.28% | 96.09% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.12% | 96.67% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.66% | 96.09% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 80.17% | 93.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus subglaucescens |
| PubChem | 162983451 |
| LOTUS | LTS0232584 |
| wikiData | Q105005342 |