7-(1-Hydroxy-8-methoxy-6-methylnaphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,8-diol
Internal ID | 26b0e683-80e7-44fe-b947-8261db09c140 |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
IUPAC Name | 7-(1-hydroxy-8-methoxy-6-methylnaphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,8-diol |
SMILES (Canonical) | CC1C(C2=C(C(N1)C)C(=C(C=C2)C3=C(C4=C(C=C3)C=C(C=C4OC)C)O)O)O |
SMILES (Isomeric) | CC1C(C2=C(C(N1)C)C(=C(C=C2)C3=C(C4=C(C=C3)C=C(C=C4OC)C)O)O)O |
InChI | InChI=1S/C23H25NO4/c1-11-9-14-5-6-15(23(27)20(14)18(10-11)28-4)16-7-8-17-19(22(16)26)12(2)24-13(3)21(17)25/h5-10,12-13,21,24-27H,1-4H3 |
InChI Key | NNCITNDNYQWFCU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H25NO4 |
Molecular Weight | 379.40 g/mol |
Exact Mass | 379.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 82.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.43% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.19% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.80% | 98.95% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.46% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.23% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.71% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.80% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.38% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.70% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.13% | 99.17% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.88% | 93.31% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.37% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.65% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.16% | 89.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.70% | 93.03% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.61% | 91.79% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.43% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 82.20% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.18% | 90.71% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.64% | 91.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.11% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.62% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triphyophyllum peltatum |
PubChem | 78183236 |
LOTUS | LTS0078424 |
wikiData | Q105182062 |