(6Z,10R)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-5,8,9,10-tetrahydro-4H-cyclonona[c]furan
| Internal ID | 2cfc450f-72e3-4cb3-b72a-a87c48a480ce |
| Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
| IUPAC Name | (6Z,10R)-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-5,8,9,10-tetrahydro-4H-cyclonona[c]furan |
| SMILES (Canonical) | CC1=CCCC2=COC=C2C(CC1)C(C)CCC=C(C)C |
| SMILES (Isomeric) | C/C/1=C/CCC2=COC=C2[C@H](CC1)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C20H30O/c1-15(2)7-5-9-17(4)19-12-11-16(3)8-6-10-18-13-21-14-20(18)19/h7-8,13-14,17,19H,5-6,9-12H2,1-4H3/b16-8-/t17-,19-/m1/s1 |
| InChI Key | GMTKEPFGCNZLDV-BLUWKUTNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.229665576 g/mol |
| Topological Polar Surface Area (TPSA) | 13.10 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.42% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.91% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.55% | 93.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.93% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.94% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.75% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.22% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.43% | 96.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.75% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.98% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.62% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.97% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.91% | 97.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.24% | 83.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.46% | 89.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.23% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23426810 |
| LOTUS | LTS0055878 |
| wikiData | Q105012164 |