(6S)-6-hydroxy-8-(4-hydroxy-3-methoxyphenyl)octan-4-one
| Internal ID | eb1dde72-7368-4a6e-a7da-108746e45ce5 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (6S)-6-hydroxy-8-(4-hydroxy-3-methoxyphenyl)octan-4-one |
| SMILES (Canonical) | CCCC(=O)CC(CCC1=CC(=C(C=C1)O)OC)O |
| SMILES (Isomeric) | CCCC(=O)C[C@H](CCC1=CC(=C(C=C1)O)OC)O |
| InChI | InChI=1S/C15H22O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,13,17-18H,3-5,7,10H2,1-2H3/t13-/m0/s1 |
| InChI Key | RGSRPNZPGBVHPU-ZDUSSCGKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.86% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.79% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.21% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.02% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.04% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.58% | 90.20% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.55% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.73% | 92.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.88% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.08% | 95.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.94% | 90.71% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.78% | 95.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.82% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.97% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber officinale |
| PubChem | 162990284 |
| LOTUS | LTS0241275 |
| wikiData | Q105236036 |