[(6S)-6-hydroxy-3-methylhenicos-3-enyl] acetate
Internal ID | 948c229c-5cb6-4ff0-b773-1737912313b0 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
IUPAC Name | [(6S)-6-hydroxy-3-methylhenicos-3-enyl] acetate |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(CC=C(C)CCOC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCC[C@@H](CC=C(C)CCOC(=O)C)O |
InChI | InChI=1S/C24H46O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)19-18-22(2)20-21-27-23(3)25/h18,24,26H,4-17,19-21H2,1-3H3/t24-/m0/s1 |
InChI Key | RFJLJZSZPKLRHG-DEOSSOPVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H46O3 |
Molecular Weight | 382.60 g/mol |
Exact Mass | 382.34469533 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.65% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 95.55% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.09% | 99.17% |
CHEMBL240 | Q12809 | HERG | 91.92% | 89.76% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.35% | 85.94% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.25% | 92.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.74% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.25% | 94.45% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.74% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.16% | 94.73% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.57% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.58% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.97% | 93.56% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.78% | 98.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.57% | 100.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.10% | 91.81% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.47% | 97.21% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.97% | 93.31% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.77% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.67% | 91.19% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.46% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stellaria media |
PubChem | 162998769 |
LOTUS | LTS0085441 |
wikiData | Q105235441 |