(6S)-6-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one
| Internal ID | aa281be3-5492-4a34-bc42-c1c8a553156c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (6S)-6-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
| SMILES (Canonical) | CC1=CC(=O)C(CC1)C(C)CCC=C(C)CO |
| SMILES (Isomeric) | CC1=CC(=O)[C@@H](CC1)[C@H](C)CC/C=C(\C)/CO |
| InChI | InChI=1S/C15H24O2/c1-11-7-8-14(15(17)9-11)13(3)6-4-5-12(2)10-16/h5,9,13-14,16H,4,6-8,10H2,1-3H3/b12-5+/t13-,14+/m1/s1 |
| InChI Key | FVWXOTXIQKDBTG-KYYFYTAESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.17% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.89% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.59% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.95% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.73% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.43% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.33% | 90.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.41% | 96.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.15% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.98% | 93.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.84% | 93.99% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.44% | 96.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.12% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.83% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.71% | 93.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.54% | 97.47% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.42% | 90.08% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.31% | 98.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.05% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gymnanthemum corymbosum |
| PubChem | 162935391 |
| LOTUS | LTS0081649 |
| wikiData | Q105002925 |