(6S)-4,6-dimethoxy-6-(2-methylbut-3-en-2-yl)furo[3,2-g]chromene-5,7-dione
| Internal ID | 6f741187-7094-4365-aca0-8e77df02263a |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Linear furanocoumarins |
| IUPAC Name | (6S)-4,6-dimethoxy-6-(2-methylbut-3-en-2-yl)furo[3,2-g]chromene-5,7-dione |
| SMILES (Canonical) | CC(C)(C=C)C1(C(=O)C2=C(C=C3C(=C2OC)C=CO3)OC1=O)OC |
| SMILES (Isomeric) | CC(C)(C=C)[C@@]1(C(=O)C2=C(C=C3C(=C2OC)C=CO3)OC1=O)OC |
| InChI | InChI=1S/C18H18O6/c1-6-17(2,3)18(22-5)15(19)13-12(24-16(18)20)9-11-10(7-8-23-11)14(13)21-4/h6-9H,1H2,2-5H3/t18-/m0/s1 |
| InChI Key | GJIFITGETLKYQN-SFHVURJKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 75.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of (6S)-4,6-dimethoxy-6-(2-methylbut-3-en-2-yl)furo[3,2-g]chromene-5,7-dione](https://plantaedb.com/storage/docs/compounds/2023/11/6s-46-dimethoxy-6-2-methylbut-3-en-2-ylfuro32-gchromene-57-dione.jpg "2D Structure of (6S)-4,6-dimethoxy-6-(2-methylbut-3-en-2-yl)furo[3,2-g]chromene-5,7-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.13% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.96% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.83% | 95.56% |
| CHEMBL240 | Q12809 | HERG | 94.24% | 89.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.56% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.04% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.99% | 98.95% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.41% | 94.03% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.58% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.44% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.62% | 93.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.78% | 93.31% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 83.27% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.48% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.37% | 89.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.87% | 96.43% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.86% | 96.00% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.73% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Halfordia kendack |
| PubChem | 637215 |
| LOTUS | LTS0191639 |
| wikiData | Q105009420 |