(6RS,10RS)-6,10-dimethylbicyclo(4.4.0)decan-3-ol
| Internal ID | 8ab0c36d-c8ca-434c-9aaa-097fb56d8be7 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclic alcohols and derivatives |
| IUPAC Name | (4aR,8R)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
| SMILES (Canonical) | CC1CCCC2(C1CC(CC2)O)C |
| SMILES (Isomeric) | C[C@@H]1CCC[C@]2(C1CC(CC2)O)C |
| InChI | InChI=1S/C12H22O/c1-9-4-3-6-12(2)7-5-10(13)8-11(9)12/h9-11,13H,3-8H2,1-2H3/t9-,10?,11?,12-/m1/s1 |
| InChI Key | MIVRQKTZEMHECK-HBIQZDMRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.50% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.79% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.52% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.72% | 92.94% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.40% | 95.58% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.48% | 98.10% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.77% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.40% | 82.69% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.37% | 95.88% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.22% | 91.11% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.03% | 91.03% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 80.76% | 97.63% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.64% | 95.38% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 80.53% | 97.64% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.49% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 130905004 |
| LOTUS | LTS0145870 |
| wikiData | Q77372993 |