(6R,8R)-5,6-dimethoxy-2,2-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[3,2-g]chromene
Internal ID | 67b99706-4f0a-4f01-8846-f3de8deae202 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6R,8R)-5,6-dimethoxy-2,2-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[3,2-g]chromene |
SMILES (Canonical) | CC1(C=CC2=C(C3=C(C=C2O1)OC(CC3OC)C4=CC=CC=C4)OC)C |
SMILES (Isomeric) | CC1(C=CC2=C(C3=C(C=C2O1)O[C@H](C[C@H]3OC)C4=CC=CC=C4)OC)C |
InChI | InChI=1S/C22H24O4/c1-22(2)11-10-15-17(26-22)13-19-20(21(15)24-4)18(23-3)12-16(25-19)14-8-6-5-7-9-14/h5-11,13,16,18H,12H2,1-4H3/t16-,18-/m1/s1 |
InChI Key | GFVVFOVUYZBZJA-SJLPKXTDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O4 |
Molecular Weight | 352.40 g/mol |
Exact Mass | 352.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 36.90 Ų |
XlogP | 4.10 |
There are no found synonyms. |
![2D Structure of (6R,8R)-5,6-dimethoxy-2,2-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[3,2-g]chromene 2D Structure of (6R,8R)-5,6-dimethoxy-2,2-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[3,2-g]chromene](https://plantaedb.com/storage/docs/compounds/2023/11/6r8r-56-dimethoxy-22-dimethyl-8-phenyl-78-dihydro-6h-pyrano32-gchromene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.90% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.22% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.15% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.17% | 97.09% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 88.93% | 94.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.77% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.64% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.37% | 90.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.15% | 89.44% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.76% | 94.08% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.59% | 92.62% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.67% | 94.97% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.59% | 94.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.16% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.16% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lonchocarpus guatemalensis |
PubChem | 162941837 |
LOTUS | LTS0146139 |
wikiData | Q105007830 |