(6r,8Ar)-6-(3,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2,3,5,6-tetrahydroindolizin-8a(1h)-ol
| Internal ID | da8595da-91b1-4503-8840-7399e1b9470b |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | (6R,8aR)-6-(3,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2,3,5,6-tetrahydro-1H-indolizin-8a-ol |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC3(CCCN3CC2C4=CC(=C(C=C4)OC)OC)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C[C@@]3(CCCN3C[C@@H]2C4=CC(=C(C=C4)OC)OC)O |
| InChI | InChI=1S/C23H27NO4/c1-26-18-8-5-16(6-9-18)19-14-23(25)11-4-12-24(23)15-20(19)17-7-10-21(27-2)22(13-17)28-3/h5-10,13-14,20,25H,4,11-12,15H2,1-3H3/t20-,23-/m1/s1 |
| InChI Key | WHTUBPJAGYKOQP-NFBKMPQASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.19400834 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 3.30 |
| (6R,8AR)-6-(3,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-1,2,3,5,6,8a-hexahydroindolizin-8a-ol |
| Tyloindicine F |
| (6r,8ar)-6-(3,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2,3,5,6-tetrahydroindolizin-8a(1h)-ol |
| NSC650393 |
| SCHEMBL8977419 |
| CHEMBL1976561 |
| DTXSID10327371 |
| NSC-650393 |
| NCI60_017549 |
| 8a(1H)-Indolizinol,4-dimethoxyphenyl)-2,3,5,6-tetrahydro- 7-(4-methoxyphenyl)-, (6R,8aR)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.06% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.79% | 85.14% |
| CHEMBL240 | Q12809 | HERG | 96.51% | 89.76% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.37% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.49% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.56% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.23% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.19% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.96% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.09% | 86.33% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.97% | 95.12% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.92% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.62% | 91.03% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.49% | 88.48% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.04% | 96.25% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 86.58% | 92.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.08% | 91.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.97% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.20% | 86.92% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.69% | 97.53% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.61% | 100.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.47% | 90.95% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.42% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 373658 |
| LOTUS | LTS0195478 |
| wikiData | Q82089104 |