(6R,7R,9R,11S)-16,17-Didehydro-9-de-2-piperidinylormosanine
| Internal ID | f93a2add-49bd-484b-b7be-74d6921e2bc1 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Aloperine and related alkaloids |
| IUPAC Name | (1S,2R,9S,10S)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)C=C4C3NCCC4 |
| SMILES (Isomeric) | C1CCN2C[C@@H]3C[C@H]([C@@H]2C1)C=C4[C@@H]3NCCC4 |
| InChI | InChI=1S/C15H24N2/c1-2-7-17-10-13-9-12(14(17)5-1)8-11-4-3-6-16-15(11)13/h8,12-16H,1-7,9-10H2/t12-,13+,14+,15+/m1/s1 |
| InChI Key | SKOLRLSBMUGVOY-QPSCCSFWSA-N |
| Popularity | 51 references in papers |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.193948774 g/mol |
| Topological Polar Surface Area (TPSA) | 15.30 Ų |
| XlogP | 1.60 |
| (6R,7R,9R,11S)-16,17-Didehydro-9-de-2-piperidinylormosanine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.26% | 97.25% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 95.14% | 91.76% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.86% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.15% | 92.94% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 91.03% | 94.78% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.49% | 93.04% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.71% | 96.09% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 86.28% | 95.61% |
| CHEMBL228 | P31645 | Serotonin transporter | 85.51% | 95.51% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.26% | 93.40% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.09% | 93.99% |
| CHEMBL238 | Q01959 | Dopamine transporter | 84.72% | 95.88% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.47% | 96.03% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.44% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.32% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 81.53% | 97.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.48% | 93.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.47% | 95.56% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.41% | 95.71% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.37% | 89.63% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.29% | 98.33% |
| CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 80.10% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sophora alopecuroides |
| Sophora tonkinensis |
| PubChem | 139055730 |
| LOTUS | LTS0112802 |
| wikiData | Q104375443 |